Security X Ray Baggage Screening Machine
General Specification 
x-ray luggage scanner
x-ray baggage scannerÂ
Airport x ray scannerÂ
security x ray machineÂ
x-ray screening machine
luggage scanner
baggage scannerÂ
x-ray security scanner
airport x-ray scanner
baggage scanning system
airport baggage scanner
luggage x-ray machine
airport x ray machines
* Tunnel Size: 500(W)*300(H)mmÂ
* Conveyor Speed: 0.22m/sÂ
* Conveyor Max Load: 150kgÂ
* Wire Resolution: 38AWGÂ
* Penetration: 8mm SteelÂ
* Film Safety: Guarantee ISO1600 FilmÂ
* X-ray Leakage: <0.2 μ Gy/h (at a distance of 5cm From external housing)Â
X-ray GeneratorÂ
* Generate direct: UpwardÂ
* Generate angle: 60 degreeÂ
* Anode Voltage: 80KvÂ
* Anode power: 0.6mAÂ
Cooling / Duty Cycle: Oil Cooling /100%Â
Image SystemÂ
* X-ray Sensor: L-Shaped Photodiode Array (monoenergetic), 12bit DeepÂ
* Monitor: High Resolution Color, LCD Accord, 17 inchÂ
* Image Processing: Edge enhancement, image strengthening, image lightening, , reducing darkening,Â
Image returning, image retrieval.Â
* Image Grey Level: 4096Â
* Image Max Resolution: 1024 * 1280 pixelÂ
* Image Processing: 24bit for processing real timeÂ
* Image storage: Storage 60000 pictures in real timeÂ
* Zoom: 32 Times Enlarge, Whole screen continuous observationÂ
Installation DataÂ
Operation temperature/Humidity: 0-45º C/20%-95%(non-condensing)Â
Storage Temperature/Humidity: -20º C-60º C/20%-95%(non-condensing)Â
Operation Power: 220VAC(± 10%)50± 3HzÂ
Power Consumption: 0.8KVAÂ
Noise: <65dBÂ
|
Tunnel Size: |
500(W)*300(H)mm |
|
Conveyor Speed: |
0.22m/s |
|
Conveyor Max Load: |
100kgs |
|
Dose per Inspection: |
<2.9 μGy/h |
|
Resolution: |
<0.101mm Metal Wire |
|
Penetration: |
8mm Steel |
|
Film Safety: |
Guarantee ISO1600 Film |
|
X-ray Leakage: |
<0.05 μGy/h (at a distance of 5cm From external housing) |
|
Generate direct: |
Upward |
|
Generate angle: |
60Â degree |
|
Anode Voltage: |
70Kv |
|
Anode power: |
0.4 to 0.5mA |
|
Cooling / Duty Cycle: |
Oil Cooling /100% |
|
X-ray Sensor: |
L-Shaped Photodiode Array (mono-energetic),  12bit Deep |
|
Monitor: |
High Resolution Color,  LCD Accord,  17 inch |
|
Image Processing: |
Edge enhancement,  image strengthening,  image lightening,  reducing darkening,  image returning,  image retrieval. |
|
Image Grey Level: |
4096 |
|
Image Max Resolution: |
1024Â *Â 1280Â pixel |
|
Image Processing: |
24bit for processing real time |
|
Image storage: |
Storage 60000 pictures in real time |
|
Zones & Zoom: |
1-9 Image regions,  2, 4, 8, 16 Times Enlarge,  Whole screen continuous observation |
|
Operation temperature/Humidity: |
0ºC-45ºC/20%-95%(non-condensing) |
|
Storage Temperature/Humidity: |
-20ºC-60ºC/20%-95%(non-condensing) |
|
Operation Power: |
220VAC(±10%)50±3Hz |
|
Power Consumption: |
1.0Â KWÂ (max), Â 0.3KW(working) |
|
Noise: |
<65db |
General Specification x-ray luggage scanner
x-ray baggage scannerÂ
Airport x ray scannerÂ
security x ray machineÂ
x-ray screening machine
luggage scanner
baggage scannerÂ
x-ray security scanner
airport x-ray scanner
baggage scanning system
airport baggage scanner
luggage x-ray machine
airport x ray machines
* Tunnel Size: 500(W)*300(H)mmÂ
* Conveyor Speed: 0.22m/sÂ
* Conveyor Max Load: 150kgÂ
* Wire Resolution: 38AWGÂ
* Penetration: 8mm SteelÂ
* Film Safety: Guarantee ISO1600 FilmÂ
* X-ray Leakage: <0.2 μ Gy/h (at a distance of 5cm From external housing)Â
X-ray GeneratorÂ
* Generate direct: UpwardÂ
* Generate angle: 60 degreeÂ
* Anode Voltage: 80KvÂ
* Anode power: 0.6mAÂ
Cooling / Duty Cycle: Oil Cooling /100%Â
Image SystemÂ
* X-ray Sensor: L-Shaped Photodiode Array (monoenergetic), 12bit DeepÂ
* Monitor: High Resolution Color, LCD Accord, 17 inchÂ
* Image Processing: Edge enhancement, image strengthening, image lightening, , reducing darkening,Â
Image returning, image retrieval.Â
* Image Grey Level: 4096Â
* Image Max Resolution: 1024 * 1280 pixelÂ
* Image Processing: 24bit for processing real timeÂ
* Image storage: Storage 60000 pictures in real timeÂ
* Zoom: 32 Times Enlarge, Whole screen continuous observationÂ
Installation DataÂ
Operation temperature/Humidity: 0-45º C/20%-95%(non-condensing)Â
Storage Temperature/Humidity: -20º C-60º C/20%-95%(non-condensing)Â
Operation Power: 220VAC(± 10%)50± 3HzÂ
Power Consumption: 0.8KVAÂ
Noise: <65dBÂ
|
Tunnel Size: |
500(W)*300(H)mm |
|
Conveyor Speed: |
0.22m/s |
|
Conveyor Max Load: |
100kgs |
|
Dose per Inspection: |
<2.9 μGy/h |
|
Resolution: |
<0.101mm Metal Wire |
|
Penetration: |
8mm Steel |
|
Film Safety: |
Guarantee ISO1600 Film |
|
X-ray Leakage: |
<0.05 μGy/h (at a distance of 5cm From external housing) |
|
Generate direct: |
Upward |
|
Generate angle: |
60Â degree |
|
Anode Voltage: |
70Kv |
|
Anode power: |
0.4 to 0.5mA |
|
Cooling / Duty Cycle: |
Oil Cooling /100% |
|
X-ray Sensor: |
L-Shaped Photodiode Array (mono-energetic),  12bit Deep |
|
Monitor: |
High Resolution Color,  LCD Accord,  17 inch |
|
Image Processing: |
Edge enhancement,  image strengthening,  image lightening,  reducing darkening,  image returning,  image retrieval. |
|
Image Grey Level: |
4096 |
|
Image Max Resolution: |
1024Â *Â 1280Â pixel |
|
Image Processing: |
24bit for processing real time |
|
Image storage: |
Storage 60000 pictures in real time |
|
Zones & Zoom: |
1-9 Image regions,  2, 4, 8, 16 Times Enlarge,  Whole screen continuous observation |
|
Operation temperature/Humidity: |
0ºC-45ºC/20%-95%(non-condensing) |
|
Storage Temperature/Humidity: |
-20ºC-60ºC/20%-95%(non-condensing) |
|
Operation Power: |
220VAC(±10%)50±3Hz |
|
Power Consumption: |
1.0Â KWÂ (max), Â 0.3KW(working) |
|
Noise: |
<65db |
*hydraulic Metering Pump can be works for long time
*It provide accuracy metering and require minimum maintenance
*It provide wide range of application: single or double head etc....
*With the design of inner changeable release safety valve and limited auto-compensation valve.
* Hydraulic actuated Diaphragm Metering Pump, no leakage.
* The flow can be adjusted from 0-100% while it's running or stopped.
* Diaphragm material: PTFE
* Both manual control and digital control for 4-20mA is available.
* Double diaphragm design with diaphragm rupture alarm system.
* Double or triple pump heads is available.
High Pressure Hydraulic Diaphragm Metering Pump
High Pressure Hydraulic Diaphragm Metering Pump,Big High Pressure Hydraulic Diaphragm Metering Pump,Small High Pressure Hydraulic Diaphragm Metering Pump,High Pressure Chemical Hydraulic Diaphragm Metering Pump
Zhejiang Ailipu Technology Co., LTD. , http://www.alipu.com